About (NE)-N-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride
(NE)-N-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride (PubChem CID 135568364) has the molecular formula C10H12ClN3O
and a molecular weight of 225.68 g/mol. Its IUPAC name is (NE)-N-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride.
Molecular Properties
| Compound Name | (NE)-N-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride |
| PubChem CID | 135568364 |
| Molecular Formula | C10H12ClN3O |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | (NE)-N-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride |
| SMILES | Cn1c(/C=N/O)[n+](C)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C10H11N3O.ClH/c1-12-8-5-3-4-6-9(8)13(2)10(12)7-11-14;/h3-7H,1-2H3;1H |
| InChIKey | LNNRTJSIPNUGCA-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 41.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride?
The IUPAC name of (NE)-N-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride (CID 135568364) is (NE)-N-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride.
What is the SMILES notation for (NE)-N-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride?
The canonical SMILES for (NE)-N-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride is Cn1c(/C=N/O)[n+](C)c2ccccc21.[Cl-].
What is the InChIKey of (NE)-N-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride?
The InChIKey is LNNRTJSIPNUGCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O.ClH/c1-12-8-5-3-4-6-9(8)13(2)10(12)7-11-14;/h3-7H,1-2H3;1H.
What are the key properties of (NE)-N-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride?
(NE)-N-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride has a molecular weight of 225.68 g/mol, XLogP of -2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methylidene]hydroxylamine chloride is sourced from PubChem (CID 135568364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).