About 5-nitro-1H-1,2,4-triazole-3-carboxylate
5-nitro-1H-1,2,4-triazole-3-carboxylate (PubChem CID 135568845) has the molecular formula C3HN4O4-
and a molecular weight of 157.06 g/mol. Its IUPAC name is 5-nitro-1H-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | 5-nitro-1H-1,2,4-triazole-3-carboxylate |
| PubChem CID | 135568845 |
| Molecular Formula | C3HN4O4- |
| Molecular Weight | 157.06 g/mol |
| Exact Mass | 157.00 |
| IUPAC Name | 5-nitro-1H-1,2,4-triazole-3-carboxylate |
| SMILES | O=C([O-])c1n[nH]c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C3H2N4O4/c8-2(9)1-4-3(6-5-1)7(10)11/h(H,8,9)(H,4,5,6)/p-1 |
| InChIKey | GCVZEDOKZHWNLP-UHFFFAOYSA-M |
| XLogP | -1.92 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.06 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-1H-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-1H-1,2,4-triazole-3-carboxylate?
The IUPAC name of 5-nitro-1H-1,2,4-triazole-3-carboxylate (CID 135568845) is 5-nitro-1H-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for 5-nitro-1H-1,2,4-triazole-3-carboxylate?
The canonical SMILES for 5-nitro-1H-1,2,4-triazole-3-carboxylate is O=C([O-])c1n[nH]c([N+](=O)[O-])n1.
What is the InChIKey of 5-nitro-1H-1,2,4-triazole-3-carboxylate?
The InChIKey is GCVZEDOKZHWNLP-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H2N4O4/c8-2(9)1-4-3(6-5-1)7(10)11/h(H,8,9)(H,4,5,6)/p-1.
What are the key properties of 5-nitro-1H-1,2,4-triazole-3-carboxylate?
5-nitro-1H-1,2,4-triazole-3-carboxylate has a molecular weight of 157.06 g/mol, XLogP of -1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-1H-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 135568845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).