C11H10N3O4S- — CID 135568863
2-[(2Z,5R)-2-[(Z)-1-(furan-2-yl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 135568863) has the molecular formula C11H10N3O4S- and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[(2Z,5R)-2-[(Z)-1-(furan-2-yl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(2Z,5R)-2-[(Z)-1-(furan-2-yl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 135568863 |
| Molecular Formula | C11H10N3O4S- |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-[(2Z,5R)-2-[(Z)-1-(furan-2-yl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | C/C(=N/N=C1/NC(=O)[C@@H](CC(=O)[O-])S1)c1ccco1 |
| InChI | InChI=1S/C11H11N3O4S/c1-6(7-3-2-4-18-7)13-14-11-12-10(17)8(19-11)5-9(15)16/h2-4,8H,5H2,1H3,(H,15,16)(H,12,14,17)/p-1/b13-6-/t8-/m1/s1 |
| InChIKey | NWYKGPYKLJWIEB-NWKJQJTJSA-M |
| XLogP | -0.27 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|