About methyl (3R)-3-acetyloxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate
methyl (3R)-3-acetyloxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 135569078) has the molecular formula C11H16N2O6
and a molecular weight of 272.26 g/mol. Its IUPAC name is methyl (3R)-3-acetyloxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
Molecular Properties
| Compound Name | methyl (3R)-3-acetyloxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| PubChem CID | 135569078 |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | methyl (3R)-3-acetyloxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | COC(=O)C(=[N+]=[N-])[C@@H](OC(C)=O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H16N2O6/c1-6(14)18-9(8(13-12)10(15)16-4)7-5-17-11(2,3)19-7/h7,9H,5H2,1-4H3/t7-,9+/m1/s1 |
| InChIKey | ZWQZJKOJIGIJLM-APPZFPTMSA-N |
| XLogP | -0.09 |
| TPSA | 107.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze methyl (3R)-3-acetyloxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3R)-3-acetyloxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate?
The IUPAC name of methyl (3R)-3-acetyloxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (CID 135569078) is methyl (3R)-3-acetyloxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
What is the SMILES notation for methyl (3R)-3-acetyloxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate?
The canonical SMILES for methyl (3R)-3-acetyloxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate is COC(=O)C(=[N+]=[N-])[C@@H](OC(C)=O)[C@H]1COC(C)(C)O1.
What is the InChIKey of methyl (3R)-3-acetyloxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate?
The InChIKey is ZWQZJKOJIGIJLM-APPZFPTMSA-N. The full InChI is InChI=1S/C11H16N2O6/c1-6(14)18-9(8(13-12)10(15)16-4)7-5-17-11(2,3)19-7/h7,9H,5H2,1-4H3/t7-,9+/m1/s1.
What are the key properties of methyl (3R)-3-acetyloxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate?
methyl (3R)-3-acetyloxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate has a molecular weight of 272.26 g/mol, XLogP of -0.09, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R)-3-acetyloxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate is sourced from PubChem (CID 135569078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).