C34H34BNO5 — CID 135569248
(4R,6aR,12aS,12bR)-2-hydroxy-4-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-5-propan-2-yl-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione (PubChem CID 135569248) has the molecular formula C34H34BNO5 and a molecular weight of 547.46 g/mol. Its IUPAC name is (4R,6aR,12aS,12bR)-2-hydroxy-4-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-5-propan-2-yl-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione.
| Compound Name | (4R,6aR,12aS,12bR)-2-hydroxy-4-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-5-propan-2-yl-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione |
|---|---|
| PubChem CID | 135569248 |
| Molecular Formula | C34H34BNO5 |
| Molecular Weight | 547.46 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | (4R,6aR,12aS,12bR)-2-hydroxy-4-[(Z)-4-(4-hydroxyphenyl)-3-pyridin-2-ylbut-3-enyl]-5-propan-2-yl-1,4,6,6a,12a,12b-hexahydronaphtho[3,2-f][2,3]benzoxaborinine-7,12-dione |
| SMILES | CC(C)C1=C2[C@@H](CC/C(=C/c3ccc(O)cc3)c3ccccn3)OB(O)C[C@@H]2[C@@H]2C(=O)c3ccccc3C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C34H34BNO5/c1-20(2)26-18-27-32(34(39)25-8-4-3-7-24(25)33(27)38)28-19-35(40)41-30(31(26)28)15-12-22(29-9-5-6-16-36-29)17-21-10-13-23(37)14-11-21/h3-11,13-14,16-17,20,27-28,30,32,37,40H,12,15,18-19H2,1-2H3/b22-17-/t27-,28+,30-,32-/m1/s1 |
| InChIKey | KFAITYAZLUNDLI-KTUVFDBISA-N |
| XLogP | 6.27 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.46 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|