C16H19N3S — CID 135569585
N-cyclopropyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135569585) has the molecular formula C16H19N3S and a molecular weight of 285.42 g/mol. Its IUPAC name is N-cyclopropyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-cyclopropyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135569585 |
| Molecular Formula | C16H19N3S |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-cyclopropyl-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | c1cc2c(cc1C1=NN/C(=N/C3CC3)SC1)CCCC2 |
| InChI | InChI=1S/C16H19N3S/c1-2-4-12-9-13(6-5-11(12)3-1)15-10-20-16(19-18-15)17-14-7-8-14/h5-6,9,14H,1-4,7-8,10H2,(H,17,19) |
| InChIKey | YQIRDVFDSBBZER-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|