About 2-ethenoxypropane
2-ethenoxypropane (PubChem CID 13557) has the molecular formula C5H10O
and a molecular weight of 86.13 g/mol. Its IUPAC name is 2-ethenoxypropane.
Molecular Properties
| Compound Name | 2-ethenoxypropane |
| PubChem CID | 13557 |
| Molecular Formula | C5H10O |
| Molecular Weight | 86.13 g/mol |
| Exact Mass | 86.07 |
| IUPAC Name | 2-ethenoxypropane |
| SMILES | C=COC(C)C |
| InChI | InChI=1S/C5H10O/c1-4-6-5(2)3/h4-5H,1H2,2-3H3 |
| InChIKey | GNUGVECARVKIPH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.13 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenoxypropane?
The IUPAC name of 2-ethenoxypropane (CID 13557) is 2-ethenoxypropane.
What is the SMILES notation for 2-ethenoxypropane?
The canonical SMILES for 2-ethenoxypropane is C=COC(C)C.
What is the InChIKey of 2-ethenoxypropane?
The InChIKey is GNUGVECARVKIPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O/c1-4-6-5(2)3/h4-5H,1H2,2-3H3.
What are the key properties of 2-ethenoxypropane?
2-ethenoxypropane has a molecular weight of 86.13 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenoxypropane is sourced from PubChem (CID 13557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).