C8H14BF4N5O2 — CID 135570689
4-amino-6-(4-methylmorpholin-4-ium-4-yl)-1H-1,3,5-triazin-2-one tetrafluoroborate (PubChem CID 135570689) has the molecular formula C8H14BF4N5O2 and a molecular weight of 299.04 g/mol. Its IUPAC name is 4-amino-6-(4-methylmorpholin-4-ium-4-yl)-1H-1,3,5-triazin-2-one tetrafluoroborate.
| Compound Name | 4-amino-6-(4-methylmorpholin-4-ium-4-yl)-1H-1,3,5-triazin-2-one tetrafluoroborate |
|---|---|
| PubChem CID | 135570689 |
| Molecular Formula | C8H14BF4N5O2 |
| Molecular Weight | 299.04 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-amino-6-(4-methylmorpholin-4-ium-4-yl)-1H-1,3,5-triazin-2-one tetrafluoroborate |
| SMILES | C[N+]1(c2nc(N)nc(=O)[nH]2)CCOCC1.F[B-](F)(F)F |
| InChI | InChI=1S/C8H13N5O2.BF4/c1-13(2-4-15-5-3-13)7-10-6(9)11-8(14)12-7;2-1(3,4)5/h2-5H2,1H3,(H2-,9,10,11,12,14);/q;-1/p+1 |
| InChIKey | QLJGYHNOHMFBRK-UHFFFAOYSA-O |
| XLogP | 0.01 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.04 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|