C16H11N3OS — CID 135572402
11-methyl-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 135572402) has the molecular formula C16H11N3OS and a molecular weight of 293.35 g/mol. Its IUPAC name is 11-methyl-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 11-methyl-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 135572402 |
| Molecular Formula | C16H11N3OS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 11-methyl-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | Cc1cc(-c2ccccc2)c2c(n1)sc1c(=O)[nH]cnc12 |
| InChI | InChI=1S/C16H11N3OS/c1-9-7-11(10-5-3-2-4-6-10)12-13-14(21-16(12)19-9)15(20)18-8-17-13/h2-8H,1H3,(H,17,18,20) |
| InChIKey | YZJZGPVDJNPLOM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |