C19H13N3O4 — CID 135572693
6-(2,3-dihydroxyphenyl)-3-phenyl-2H-pyrazolo[3,4-b]pyridine-4-carboxylic acid (PubChem CID 135572693) has the molecular formula C19H13N3O4 and a molecular weight of 347.33 g/mol. Its IUPAC name is 6-(2,3-dihydroxyphenyl)-3-phenyl-2H-pyrazolo[3,4-b]pyridine-4-carboxylic acid.
| Compound Name | 6-(2,3-dihydroxyphenyl)-3-phenyl-2H-pyrazolo[3,4-b]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 135572693 |
| Molecular Formula | C19H13N3O4 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 6-(2,3-dihydroxyphenyl)-3-phenyl-2H-pyrazolo[3,4-b]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cccc(O)c2O)nc2n[nH]c(-c3ccccc3)c12 |
| InChI | InChI=1S/C19H13N3O4/c23-14-8-4-7-11(17(14)24)13-9-12(19(25)26)15-16(21-22-18(15)20-13)10-5-2-1-3-6-10/h1-9,23-24H,(H,25,26)(H,20,21,22) |
| InChIKey | VHZJXNMPMJBCND-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|