C24H23FN4O3S — CID 135572838
9-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135572838) has the molecular formula C24H23FN4O3S and a molecular weight of 466.54 g/mol. Its IUPAC name is 9-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135572838 |
| Molecular Formula | C24H23FN4O3S |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 9-(3,4-dimethoxyphenyl)-2-[(4-fluorophenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1ccc(C2C3=C(CCCC3=O)Nc3nc(SCc4ccc(F)cc4)nn32)cc1OC |
| InChI | InChI=1S/C24H23FN4O3S/c1-31-19-11-8-15(12-20(19)32-2)22-21-17(4-3-5-18(21)30)26-23-27-24(28-29(22)23)33-13-14-6-9-16(25)10-7-14/h6-12,22H,3-5,13H2,1-2H3,(H,26,27,28) |
| InChIKey | APWRRBSLMUQYRR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |