C22H25N3O3 — CID 135573046
1-[2,4-bis(2-hydroxyphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-9-yl]ethanone (PubChem CID 135573046) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-[2,4-bis(2-hydroxyphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-9-yl]ethanone.
| Compound Name | 1-[2,4-bis(2-hydroxyphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-9-yl]ethanone |
|---|---|
| PubChem CID | 135573046 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-[2,4-bis(2-hydroxyphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-9-yl]ethanone |
| SMILES | CC(=O)N1CCC2(CC1)N=C(c1ccccc1O)CC(c1ccccc1O)N2 |
| InChI | InChI=1S/C22H25N3O3/c1-15(26)25-12-10-22(11-13-25)23-18(16-6-2-4-8-20(16)27)14-19(24-22)17-7-3-5-9-21(17)28/h2-9,18,23,27-28H,10-14H2,1H3 |
| InChIKey | FRXNPEBDBHDPJT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|