About 8-[(E)-[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,5-dihydropurin-6-one
8-[(E)-[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,5-dihydropurin-6-one (PubChem CID 135573456) has the molecular formula C10H14ClN7O
and a molecular weight of 283.72 g/mol. Its IUPAC name is 8-[(E)-[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,5-dihydropurin-6-one.
Molecular Properties
| Compound Name | 8-[(E)-[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,5-dihydropurin-6-one |
| PubChem CID | 135573456 |
| Molecular Formula | C10H14ClN7O |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 8-[(E)-[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,5-dihydropurin-6-one |
| SMILES | CC(C)N(CCCl)/N=N/C1=NC2C(=O)NC=NC2=N1 |
| InChI | InChI=1S/C10H14ClN7O/c1-6(2)18(4-3-11)17-16-10-14-7-8(15-10)12-5-13-9(7)19/h5-7H,3-4H2,1-2H3,(H,12,13,14,15,19)/b17-16+ |
| InChIKey | GWYPKVJMUIFFNA-WUKNDPDISA-N |
| XLogP | 0.60 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-[(E)-[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,5-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(E)-[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,5-dihydropurin-6-one?
The IUPAC name of 8-[(E)-[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,5-dihydropurin-6-one (CID 135573456) is 8-[(E)-[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,5-dihydropurin-6-one.
What is the SMILES notation for 8-[(E)-[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,5-dihydropurin-6-one?
The canonical SMILES for 8-[(E)-[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,5-dihydropurin-6-one is CC(C)N(CCCl)/N=N/C1=NC2C(=O)NC=NC2=N1.
What is the InChIKey of 8-[(E)-[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,5-dihydropurin-6-one?
The InChIKey is GWYPKVJMUIFFNA-WUKNDPDISA-N. The full InChI is InChI=1S/C10H14ClN7O/c1-6(2)18(4-3-11)17-16-10-14-7-8(15-10)12-5-13-9(7)19/h5-7H,3-4H2,1-2H3,(H,12,13,14,15,19)/b17-16+.
What are the key properties of 8-[(E)-[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,5-dihydropurin-6-one?
8-[(E)-[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,5-dihydropurin-6-one has a molecular weight of 283.72 g/mol, XLogP of 0.60, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(E)-[2-chloroethyl(propan-2-yl)amino]diazenyl]-1,5-dihydropurin-6-one is sourced from PubChem (CID 135573456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).