About 7-oxo-6H-[1,2]thiazolo[4,5-d]pyrimidine-3-carboxylic acid
7-oxo-6H-[1,2]thiazolo[4,5-d]pyrimidine-3-carboxylic acid (PubChem CID 135573891) has the molecular formula C6H3N3O3S
and a molecular weight of 197.17 g/mol. Its IUPAC name is 7-oxo-6H-[1,2]thiazolo[4,5-d]pyrimidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 7-oxo-6H-[1,2]thiazolo[4,5-d]pyrimidine-3-carboxylic acid |
| PubChem CID | 135573891 |
| Molecular Formula | C6H3N3O3S |
| Molecular Weight | 197.17 g/mol |
| Exact Mass | 196.99 |
| IUPAC Name | 7-oxo-6H-[1,2]thiazolo[4,5-d]pyrimidine-3-carboxylic acid |
| SMILES | O=C(O)c1nsc2c(=O)[nH]cnc12 |
| InChI | InChI=1S/C6H3N3O3S/c10-5-4-2(7-1-8-5)3(6(11)12)9-13-4/h1H,(H,11,12)(H,7,8,10) |
| InChIKey | PABSWCJJJBGCMJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.17 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-oxo-6H-[1,2]thiazolo[4,5-d]pyrimidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxo-6H-[1,2]thiazolo[4,5-d]pyrimidine-3-carboxylic acid?
The IUPAC name of 7-oxo-6H-[1,2]thiazolo[4,5-d]pyrimidine-3-carboxylic acid (CID 135573891) is 7-oxo-6H-[1,2]thiazolo[4,5-d]pyrimidine-3-carboxylic acid.
What is the SMILES notation for 7-oxo-6H-[1,2]thiazolo[4,5-d]pyrimidine-3-carboxylic acid?
The canonical SMILES for 7-oxo-6H-[1,2]thiazolo[4,5-d]pyrimidine-3-carboxylic acid is O=C(O)c1nsc2c(=O)[nH]cnc12.
What is the InChIKey of 7-oxo-6H-[1,2]thiazolo[4,5-d]pyrimidine-3-carboxylic acid?
The InChIKey is PABSWCJJJBGCMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3O3S/c10-5-4-2(7-1-8-5)3(6(11)12)9-13-4/h1H,(H,11,12)(H,7,8,10).
What are the key properties of 7-oxo-6H-[1,2]thiazolo[4,5-d]pyrimidine-3-carboxylic acid?
7-oxo-6H-[1,2]thiazolo[4,5-d]pyrimidine-3-carboxylic acid has a molecular weight of 197.17 g/mol, XLogP of 0.08, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxo-6H-[1,2]thiazolo[4,5-d]pyrimidine-3-carboxylic acid is sourced from PubChem (CID 135573891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).