About 8-methylsulfanyl-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazol-2-one
8-methylsulfanyl-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazol-2-one (PubChem CID 135574092) has the molecular formula C11H11N3OS
and a molecular weight of 233.30 g/mol. Its IUPAC name is 8-methylsulfanyl-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazol-2-one.
Molecular Properties
| Compound Name | 8-methylsulfanyl-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazol-2-one |
| PubChem CID | 135574092 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 8-methylsulfanyl-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazol-2-one |
| SMILES | CSc1ccc2c(c1)nc1n2CCC(=O)N1 |
| InChI | InChI=1S/C11H11N3OS/c1-16-7-2-3-9-8(6-7)12-11-13-10(15)4-5-14(9)11/h2-3,6H,4-5H2,1H3,(H,12,13,15) |
| InChIKey | YBPAGIDHPNXNDD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methylsulfanyl-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylsulfanyl-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazol-2-one?
The IUPAC name of 8-methylsulfanyl-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazol-2-one (CID 135574092) is 8-methylsulfanyl-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazol-2-one.
What is the SMILES notation for 8-methylsulfanyl-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazol-2-one?
The canonical SMILES for 8-methylsulfanyl-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazol-2-one is CSc1ccc2c(c1)nc1n2CCC(=O)N1.
What is the InChIKey of 8-methylsulfanyl-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazol-2-one?
The InChIKey is YBPAGIDHPNXNDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3OS/c1-16-7-2-3-9-8(6-7)12-11-13-10(15)4-5-14(9)11/h2-3,6H,4-5H2,1H3,(H,12,13,15).
What are the key properties of 8-methylsulfanyl-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazol-2-one?
8-methylsulfanyl-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazol-2-one has a molecular weight of 233.30 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylsulfanyl-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazol-2-one is sourced from PubChem (CID 135574092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).