C18H14ClN3O6 — CID 135574217
4-[(Z)-2-chloro-2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethenyl]-2-methoxy-6-nitrophenol (PubChem CID 135574217) has the molecular formula C18H14ClN3O6 and a molecular weight of 403.78 g/mol. Its IUPAC name is 4-[(Z)-2-chloro-2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethenyl]-2-methoxy-6-nitrophenol.
| Compound Name | 4-[(Z)-2-chloro-2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethenyl]-2-methoxy-6-nitrophenol |
|---|---|
| PubChem CID | 135574217 |
| Molecular Formula | C18H14ClN3O6 |
| Molecular Weight | 403.78 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 4-[(Z)-2-chloro-2-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethenyl]-2-methoxy-6-nitrophenol |
| SMILES | COc1ccccc1-c1noc(/C(Cl)=C/c2cc(OC)c(O)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C18H14ClN3O6/c1-26-14-6-4-3-5-11(14)17-20-18(28-21-17)12(19)7-10-8-13(22(24)25)16(23)15(9-10)27-2/h3-9,23H,1-2H3/b12-7- |
| InChIKey | IRLCQMCLTBSBAJ-GHXNOFRVSA-N |
| XLogP | 4.10 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.78 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|