C8H6N2O3S — CID 135574467
5-(3,4-dihydroxyphenyl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 135574467) has the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. Its IUPAC name is 5-(3,4-dihydroxyphenyl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(3,4-dihydroxyphenyl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 135574467 |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 5-(3,4-dihydroxyphenyl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | Oc1ccc(-c2n[nH]c(=S)o2)cc1O |
| InChI | InChI=1S/C8H6N2O3S/c11-5-2-1-4(3-6(5)12)7-9-10-8(14)13-7/h1-3,11-12H,(H,10,14) |
| InChIKey | OKRMJUPASFYVMN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|