C13H14Br2N6OS — CID 135574487
2-[(Z)-[6-(2,5-dibromothiophen-3-yl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]-1-hydroxyguanidine (PubChem CID 135574487) has the molecular formula C13H14Br2N6OS and a molecular weight of 462.17 g/mol. Its IUPAC name is 2-[(Z)-[6-(2,5-dibromothiophen-3-yl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]-1-hydroxyguanidine.
| Compound Name | 2-[(Z)-[6-(2,5-dibromothiophen-3-yl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 135574487 |
| Molecular Formula | C13H14Br2N6OS |
| Molecular Weight | 462.17 g/mol |
| Exact Mass | 459.93 |
| IUPAC Name | 2-[(Z)-[6-(2,5-dibromothiophen-3-yl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]-1-hydroxyguanidine |
| SMILES | Cc1[nH]nc2c1/C(=N\N=C(/N)NO)CC(c1cc(Br)sc1Br)C2 |
| InChI | InChI=1S/C13H14Br2N6OS/c1-5-11-8(18-17-5)2-6(7-4-10(14)23-12(7)15)3-9(11)19-20-13(16)21-22/h4,6,22H,2-3H2,1H3,(H,17,18)(H3,16,20,21)/b19-9- |
| InChIKey | CFWRTHHEZYLMME-OCKHKDLRSA-N |
| XLogP | 3.03 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|