C12H21N4O+ — CID 135575591
5-ethyl-4-methyl-2-(4-methylpiperazin-4-ium-1-yl)-1H-pyrimidin-6-one (PubChem CID 135575591) has the molecular formula C12H21N4O+ and a molecular weight of 237.33 g/mol. Its IUPAC name is 5-ethyl-4-methyl-2-(4-methylpiperazin-4-ium-1-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-ethyl-4-methyl-2-(4-methylpiperazin-4-ium-1-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135575591 |
| Molecular Formula | C12H21N4O+ |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 5-ethyl-4-methyl-2-(4-methylpiperazin-4-ium-1-yl)-1H-pyrimidin-6-one |
| SMILES | CCc1c(C)nc(N2CC[NH+](C)CC2)[nH]c1=O |
| InChI | InChI=1S/C12H20N4O/c1-4-10-9(2)13-12(14-11(10)17)16-7-5-15(3)6-8-16/h4-8H2,1-3H3,(H,13,14,17)/p+1 |
| InChIKey | IFMGSLCREPSEBV-UHFFFAOYSA-O |
| XLogP | -1.02 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |