About 2-[(E)-N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol
2-[(E)-N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol (PubChem CID 135576308) has the molecular formula C15H22N2O
and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-[(E)-N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol.
Molecular Properties
| Compound Name | 2-[(E)-N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol |
| PubChem CID | 135576308 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-[(E)-N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol |
| SMILES | C/C(=N\N1C(C)CCCC1C)c1ccccc1O |
| InChI | InChI=1S/C15H22N2O/c1-11-7-6-8-12(2)17(11)16-13(3)14-9-4-5-10-15(14)18/h4-5,9-12,18H,6-8H2,1-3H3/b16-13+ |
| InChIKey | ZGMIGNCBBQMJEL-DTQAZKPQSA-N |
| XLogP | 3.38 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol?
The IUPAC name of 2-[(E)-N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol (CID 135576308) is 2-[(E)-N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol.
What is the SMILES notation for 2-[(E)-N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol?
The canonical SMILES for 2-[(E)-N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol is C/C(=N\N1C(C)CCCC1C)c1ccccc1O.
What is the InChIKey of 2-[(E)-N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol?
The InChIKey is ZGMIGNCBBQMJEL-DTQAZKPQSA-N. The full InChI is InChI=1S/C15H22N2O/c1-11-7-6-8-12(2)17(11)16-13(3)14-9-4-5-10-15(14)18/h4-5,9-12,18H,6-8H2,1-3H3/b16-13+.
What are the key properties of 2-[(E)-N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol?
2-[(E)-N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol has a molecular weight of 246.35 g/mol, XLogP of 3.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol is sourced from PubChem (CID 135576308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).