About [3-[(E)-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzenesulfonate
[3-[(E)-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzenesulfonate (PubChem CID 135576357) has the molecular formula C16H12BrN3O4S2
and a molecular weight of 454.33 g/mol. Its IUPAC name is [3-[(E)-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzenesulfonate.
Molecular Properties
| Compound Name | [3-[(E)-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzenesulfonate |
| PubChem CID | 135576357 |
| Molecular Formula | C16H12BrN3O4S2 |
| Molecular Weight | 454.33 g/mol |
| Exact Mass | 452.95 |
| IUPAC Name | [3-[(E)-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzenesulfonate |
| SMILES | O=C1CS/C(=N/N=C/c2cccc(OS(=O)(=O)c3ccc(Br)cc3)c2)N1 |
| InChI | InChI=1S/C16H12BrN3O4S2/c17-12-4-6-14(7-5-12)26(22,23)24-13-3-1-2-11(8-13)9-18-20-16-19-15(21)10-25-16/h1-9H,10H2,(H,19,20,21)/b18-9+ |
| InChIKey | GPXLHEQIPLPIPM-GIJQJNRQSA-N |
| XLogP | 2.77 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[(E)-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(E)-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzenesulfonate?
The IUPAC name of [3-[(E)-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzenesulfonate (CID 135576357) is [3-[(E)-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzenesulfonate.
What is the SMILES notation for [3-[(E)-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzenesulfonate?
The canonical SMILES for [3-[(E)-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzenesulfonate is O=C1CS/C(=N/N=C/c2cccc(OS(=O)(=O)c3ccc(Br)cc3)c2)N1.
What is the InChIKey of [3-[(E)-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzenesulfonate?
The InChIKey is GPXLHEQIPLPIPM-GIJQJNRQSA-N. The full InChI is InChI=1S/C16H12BrN3O4S2/c17-12-4-6-14(7-5-12)26(22,23)24-13-3-1-2-11(8-13)9-18-20-16-19-15(21)10-25-16/h1-9H,10H2,(H,19,20,21)/b18-9+.
What are the key properties of [3-[(E)-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzenesulfonate?
[3-[(E)-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzenesulfonate has a molecular weight of 454.33 g/mol, XLogP of 2.77, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(E)-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-bromobenzenesulfonate is sourced from PubChem (CID 135576357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).