C20H26N4O4S — CID 135577408
ethyl 5-[(E)-N-[(3,4-dimethoxyphenyl)carbamothioylamino]-C-methylcarbonimidoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 135577408) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is ethyl 5-[(E)-N-[(3,4-dimethoxyphenyl)carbamothioylamino]-C-methylcarbonimidoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[(E)-N-[(3,4-dimethoxyphenyl)carbamothioylamino]-C-methylcarbonimidoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 135577408 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | ethyl 5-[(E)-N-[(3,4-dimethoxyphenyl)carbamothioylamino]-C-methylcarbonimidoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(/C(C)=N/NC(=S)Nc2ccc(OC)c(OC)c2)c1C |
| InChI | InChI=1S/C20H26N4O4S/c1-7-28-19(25)17-11(2)18(21-12(17)3)13(4)23-24-20(29)22-14-8-9-15(26-5)16(10-14)27-6/h8-10,21H,7H2,1-6H3,(H2,22,24,29)/b23-13+ |
| InChIKey | SOVOLTROTPEGDZ-YDZHTSKRSA-N |
| XLogP | 3.54 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|