C15H12ClN5O3 — CID 135577508
(9S)-9-(2-chloro-5-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135577508) has the molecular formula C15H12ClN5O3 and a molecular weight of 345.75 g/mol. Its IUPAC name is (9S)-9-(2-chloro-5-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9S)-9-(2-chloro-5-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135577508 |
| Molecular Formula | C15H12ClN5O3 |
| Molecular Weight | 345.75 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | (9S)-9-(2-chloro-5-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | O=C1CCCC2=C1[C@@H](c1cc([N+](=O)[O-])ccc1Cl)n1ncnc1N2 |
| InChI | InChI=1S/C15H12ClN5O3/c16-10-5-4-8(21(23)24)6-9(10)14-13-11(2-1-3-12(13)22)19-15-17-7-18-20(14)15/h4-7,14H,1-3H2,(H,17,18,19)/t14-/m1/s1 |
| InChIKey | JPIUEIKISYXEON-CQSZACIVSA-N |
| XLogP | 2.86 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.75 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|