C7H9N5O2 — CID 135577860
6-imino-1,3-dimethyl-7,9-dihydropurine-2,8-dione (PubChem CID 135577860) has the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. Its IUPAC name is 6-imino-1,3-dimethyl-7,9-dihydropurine-2,8-dione.
| Compound Name | 6-imino-1,3-dimethyl-7,9-dihydropurine-2,8-dione |
|---|---|
| PubChem CID | 135577860 |
| Molecular Formula | C7H9N5O2 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 6-imino-1,3-dimethyl-7,9-dihydropurine-2,8-dione |
| SMILES | [H]/N=c1/c2[nH]c(=O)[nH]c2n(C)c(=O)n1C |
| InChI | InChI=1S/C7H9N5O2/c1-11-4(8)3-5(10-6(13)9-3)12(2)7(11)14/h8H,1-2H3,(H2,9,10,13)/b8-4- |
| InChIKey | QODFADPTUYFJNH-YWEYNIOJSA-N |
| XLogP | -1.63 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |