C10H11N3S — CID 135577921
3,5-dimethyl-1H-1,3,4-benzotriazepine-2-thione (PubChem CID 135577921) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is 3,5-dimethyl-1H-1,3,4-benzotriazepine-2-thione.
| Compound Name | 3,5-dimethyl-1H-1,3,4-benzotriazepine-2-thione |
|---|---|
| PubChem CID | 135577921 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3,5-dimethyl-1H-1,3,4-benzotriazepine-2-thione |
| SMILES | CC1=NN(C)C(=S)Nc2ccccc21 |
| InChI | InChI=1S/C10H11N3S/c1-7-8-5-3-4-6-9(8)11-10(14)13(2)12-7/h3-6H,1-2H3,(H,11,14) |
| InChIKey | LIOSVYWOTRKEAG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|