C9H8N4O — CID 135577973
2,4,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,10,12-tetraen-8-one (PubChem CID 135577973) has the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. Its IUPAC name is 2,4,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,10,12-tetraen-8-one.
| Compound Name | 2,4,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,10,12-tetraen-8-one |
|---|---|
| PubChem CID | 135577973 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 2,4,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,10,12-tetraen-8-one |
| SMILES | O=c1c2cccnc2nc2n1CCN2 |
| InChI | InChI=1S/C9H8N4O/c14-8-6-2-1-3-10-7(6)12-9-11-4-5-13(8)9/h1-3H,4-5H2,(H,10,11,12) |
| InChIKey | XHMYYIKIHJSNHL-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |