About 3-anilino-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one
3-anilino-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 135577998) has the molecular formula C11H9N5O
and a molecular weight of 227.23 g/mol. Its IUPAC name is 3-anilino-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-anilino-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
| PubChem CID | 135577998 |
| Molecular Formula | C11H9N5O |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 3-anilino-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2n[nH]c(Nc3ccccc3)c12 |
| InChI | InChI=1S/C11H9N5O/c17-11-8-9(12-6-13-11)15-16-10(8)14-7-4-2-1-3-5-7/h1-6H,(H3,12,13,14,15,16,17) |
| InChIKey | IJABHNBUIYHHIG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-anilino-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-anilino-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one?
The IUPAC name of 3-anilino-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one (CID 135577998) is 3-anilino-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 3-anilino-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one?
The canonical SMILES for 3-anilino-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one is O=c1[nH]cnc2n[nH]c(Nc3ccccc3)c12.
What is the InChIKey of 3-anilino-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one?
The InChIKey is IJABHNBUIYHHIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5O/c17-11-8-9(12-6-13-11)15-16-10(8)14-7-4-2-1-3-5-7/h1-6H,(H3,12,13,14,15,16,17).
What are the key properties of 3-anilino-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one?
3-anilino-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one has a molecular weight of 227.23 g/mol, XLogP of 1.39, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-anilino-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 135577998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).