C18H10ClNO4 — CID 135578215
1-chloro-6,11-dihydroxy-4-methylnaphtho[2,3-g]isoquinoline-5,12-dione (PubChem CID 135578215) has the molecular formula C18H10ClNO4 and a molecular weight of 339.73 g/mol. Its IUPAC name is 1-chloro-6,11-dihydroxy-4-methylnaphtho[2,3-g]isoquinoline-5,12-dione.
| Compound Name | 1-chloro-6,11-dihydroxy-4-methylnaphtho[2,3-g]isoquinoline-5,12-dione |
|---|---|
| PubChem CID | 135578215 |
| Molecular Formula | C18H10ClNO4 |
| Molecular Weight | 339.73 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 1-chloro-6,11-dihydroxy-4-methylnaphtho[2,3-g]isoquinoline-5,12-dione |
| SMILES | Cc1cnc(Cl)c2c1C(=O)c1c(c(O)c3ccccc3c1O)C2=O |
| InChI | InChI=1S/C18H10ClNO4/c1-7-6-20-18(19)13-10(7)16(23)11-12(17(13)24)15(22)9-5-3-2-4-8(9)14(11)21/h2-6,21-22H,1H3 |
| InChIKey | WQPJNOFOTIJGMQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.73 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|