C20H14ClF3N2O2 — CID 135578239
(1E)-7-chloro-1-hydroxyimino-3-[4-(trifluoromethyl)phenyl]-2,3,4,10-tetrahydroacridin-9-one (PubChem CID 135578239) has the molecular formula C20H14ClF3N2O2 and a molecular weight of 406.79 g/mol. Its IUPAC name is (1E)-7-chloro-1-hydroxyimino-3-[4-(trifluoromethyl)phenyl]-2,3,4,10-tetrahydroacridin-9-one.
| Compound Name | (1E)-7-chloro-1-hydroxyimino-3-[4-(trifluoromethyl)phenyl]-2,3,4,10-tetrahydroacridin-9-one |
|---|---|
| PubChem CID | 135578239 |
| Molecular Formula | C20H14ClF3N2O2 |
| Molecular Weight | 406.79 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | (1E)-7-chloro-1-hydroxyimino-3-[4-(trifluoromethyl)phenyl]-2,3,4,10-tetrahydroacridin-9-one |
| SMILES | O=c1c2c([nH]c3ccc(Cl)cc13)CC(c1ccc(C(F)(F)F)cc1)C/C2=N\O |
| InChI | InChI=1S/C20H14ClF3N2O2/c21-13-5-6-15-14(9-13)19(27)18-16(25-15)7-11(8-17(18)26-28)10-1-3-12(4-2-10)20(22,23)24/h1-6,9,11,28H,7-8H2,(H,25,27)/b26-17+ |
| InChIKey | FMUFYOSZETYEAK-YZSQISJMSA-N |
| XLogP | 5.11 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.79 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|