C23H21ClN4O2 — CID 135578419
2-chloro-N-[(E)-[5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-4-methylbenzamide (PubChem CID 135578419) has the molecular formula C23H21ClN4O2 and a molecular weight of 420.90 g/mol. Its IUPAC name is 2-chloro-N-[(E)-[5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[(E)-[5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 135578419 |
| Molecular Formula | C23H21ClN4O2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-chloro-N-[(E)-[5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/N=C/c2cc(/N=N/c3ccc(C)c(C)c3)ccc2O)c(Cl)c1 |
| InChI | InChI=1S/C23H21ClN4O2/c1-14-4-8-20(21(24)10-14)23(30)28-25-13-17-12-19(7-9-22(17)29)27-26-18-6-5-15(2)16(3)11-18/h4-13,29H,1-3H3,(H,28,30)/b25-13+,27-26+ |
| InChIKey | XUQSZCFKKZOYAF-ZGQMNJRFSA-N |
| XLogP | 6.15 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|