About 2-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-4-bromophenol
2-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-4-bromophenol (PubChem CID 135579415) has the molecular formula C18H13BrN4O
and a molecular weight of 381.23 g/mol. Its IUPAC name is 2-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-4-bromophenol.
Molecular Properties
| Compound Name | 2-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-4-bromophenol |
| PubChem CID | 135579415 |
| Molecular Formula | C18H13BrN4O |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 2-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-4-bromophenol |
| SMILES | Oc1ccc(Br)cc1-c1nc2cnccn2c1Nc1ccccc1 |
| InChI | InChI=1S/C18H13BrN4O/c19-12-6-7-15(24)14(10-12)17-18(21-13-4-2-1-3-5-13)23-9-8-20-11-16(23)22-17/h1-11,21,24H |
| InChIKey | YQIHZYJICWDGLU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-4-bromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-4-bromophenol?
The IUPAC name of 2-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-4-bromophenol (CID 135579415) is 2-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-4-bromophenol.
What is the SMILES notation for 2-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-4-bromophenol?
The canonical SMILES for 2-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-4-bromophenol is Oc1ccc(Br)cc1-c1nc2cnccn2c1Nc1ccccc1.
What is the InChIKey of 2-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-4-bromophenol?
The InChIKey is YQIHZYJICWDGLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrN4O/c19-12-6-7-15(24)14(10-12)17-18(21-13-4-2-1-3-5-13)23-9-8-20-11-16(23)22-17/h1-11,21,24H.
What are the key properties of 2-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-4-bromophenol?
2-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-4-bromophenol has a molecular weight of 381.23 g/mol, XLogP of 4.61, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-anilinoimidazo[1,2-a]pyrazin-2-yl)-4-bromophenol is sourced from PubChem (CID 135579415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).