C26H22N6O2 — CID 135579645
2-[4-(1,3-benzoxazol-2-ylamino)-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3,5-triazin-2-yl]phenol (PubChem CID 135579645) has the molecular formula C26H22N6O2 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-2-ylamino)-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3,5-triazin-2-yl]phenol.
| Compound Name | 2-[4-(1,3-benzoxazol-2-ylamino)-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3,5-triazin-2-yl]phenol |
|---|---|
| PubChem CID | 135579645 |
| Molecular Formula | C26H22N6O2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-2-ylamino)-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1,3,5-triazin-2-yl]phenol |
| SMILES | CN(C)c1ccc(/C=C/c2nc(Nc3nc4ccccc4o3)nc(-c3ccccc3O)n2)cc1 |
| InChI | InChI=1S/C26H22N6O2/c1-32(2)18-14-11-17(12-15-18)13-16-23-28-24(19-7-3-5-9-21(19)33)30-25(29-23)31-26-27-20-8-4-6-10-22(20)34-26/h3-16,33H,1-2H3,(H,27,28,29,30,31)/b16-13+ |
| InChIKey | HGZJYGMMWHYTRZ-DTQAZKPQSA-N |
| XLogP | 5.37 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|