C17H20N2O4 — CID 135580381
N-[(E)-(4-hydroxyphenyl)methylideneamino]-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 135580381) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-[(E)-(4-hydroxyphenyl)methylideneamino]-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 135580381 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC12CCC(C(=O)N/N=C/c3ccc(O)cc3)(OC1=O)C2(C)C |
| InChI | InChI=1S/C17H20N2O4/c1-15(2)16(3)8-9-17(15,23-14(16)22)13(21)19-18-10-11-4-6-12(20)7-5-11/h4-7,10,20H,8-9H2,1-3H3,(H,19,21)/b18-10+ |
| InChIKey | ZFJAJJMVEFGBKX-VCHYOVAHSA-N |
| XLogP | 1.96 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|