About 2-(ethylamino)-4,5-dimethyl-1H-pyrimidin-6-one
2-(ethylamino)-4,5-dimethyl-1H-pyrimidin-6-one (PubChem CID 135581387) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-(ethylamino)-4,5-dimethyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-(ethylamino)-4,5-dimethyl-1H-pyrimidin-6-one |
| PubChem CID | 135581387 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-(ethylamino)-4,5-dimethyl-1H-pyrimidin-6-one |
| SMILES | CCNc1nc(C)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C8H13N3O/c1-4-9-8-10-6(3)5(2)7(12)11-8/h4H2,1-3H3,(H2,9,10,11,12) |
| InChIKey | NYXJWVZIPKRMEF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(ethylamino)-4,5-dimethyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)-4,5-dimethyl-1H-pyrimidin-6-one?
The IUPAC name of 2-(ethylamino)-4,5-dimethyl-1H-pyrimidin-6-one (CID 135581387) is 2-(ethylamino)-4,5-dimethyl-1H-pyrimidin-6-one.
What is the SMILES notation for 2-(ethylamino)-4,5-dimethyl-1H-pyrimidin-6-one?
The canonical SMILES for 2-(ethylamino)-4,5-dimethyl-1H-pyrimidin-6-one is CCNc1nc(C)c(C)c(=O)[nH]1.
What is the InChIKey of 2-(ethylamino)-4,5-dimethyl-1H-pyrimidin-6-one?
The InChIKey is NYXJWVZIPKRMEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-4-9-8-10-6(3)5(2)7(12)11-8/h4H2,1-3H3,(H2,9,10,11,12).
What are the key properties of 2-(ethylamino)-4,5-dimethyl-1H-pyrimidin-6-one?
2-(ethylamino)-4,5-dimethyl-1H-pyrimidin-6-one has a molecular weight of 167.21 g/mol, XLogP of 0.82, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)-4,5-dimethyl-1H-pyrimidin-6-one is sourced from PubChem (CID 135581387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).