C13H15Cl3N6S — CID 135581620
2-[(Z)-[6-(2,5-dichlorothiophen-3-yl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]guanidine;hydrochloride (PubChem CID 135581620) has the molecular formula C13H15Cl3N6S and a molecular weight of 393.73 g/mol. Its IUPAC name is 2-[(Z)-[6-(2,5-dichlorothiophen-3-yl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]guanidine;hydrochloride.
| Compound Name | 2-[(Z)-[6-(2,5-dichlorothiophen-3-yl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 135581620 |
| Molecular Formula | C13H15Cl3N6S |
| Molecular Weight | 393.73 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 2-[(Z)-[6-(2,5-dichlorothiophen-3-yl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]guanidine;hydrochloride |
| SMILES | Cc1[nH]nc2c1/C(=N\N=C(N)N)CC(c1cc(Cl)sc1Cl)C2.Cl |
| InChI | InChI=1S/C13H14Cl2N6S.ClH/c1-5-11-8(19-18-5)2-6(3-9(11)20-21-13(16)17)7-4-10(14)22-12(7)15;/h4,6H,2-3H2,1H3,(H,18,19)(H4,16,17,21);1H/b20-9-; |
| InChIKey | QIIDLVVFKNHUDF-REMKHYEUSA-N |
| XLogP | 3.22 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.73 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|