C16H20Cl2N6 — CID 135581645
1-[(Z)-[6-(2-chlorophenyl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]-2-methylguanidine;hydrochloride (PubChem CID 135581645) has the molecular formula C16H20Cl2N6 and a molecular weight of 367.28 g/mol. Its IUPAC name is 1-[(Z)-[6-(2-chlorophenyl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]-2-methylguanidine;hydrochloride.
| Compound Name | 1-[(Z)-[6-(2-chlorophenyl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]-2-methylguanidine;hydrochloride |
|---|---|
| PubChem CID | 135581645 |
| Molecular Formula | C16H20Cl2N6 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-[(Z)-[6-(2-chlorophenyl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]-2-methylguanidine;hydrochloride |
| SMILES | C/N=C(\N)N/N=C1/CC(c2ccccc2Cl)Cc2n[nH]c(C)c21.Cl |
| InChI | InChI=1S/C16H19ClN6.ClH/c1-9-15-13(21-20-9)7-10(11-5-3-4-6-12(11)17)8-14(15)22-23-16(18)19-2;/h3-6,10H,7-8H2,1-2H3,(H,20,21)(H3,18,19,23);1H/b22-14-; |
| InChIKey | WEPYWOFIEBHWQJ-YDHFHHHVSA-N |
| XLogP | 2.76 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|