C23H27F3N4O4S — CID 135581665
4-hydroxy-3-[(E)-3-[4-(1-methylsulfonylpiperidin-4-yl)oxy-3-(trifluoromethyl)anilino]prop-1-enyl]benzenecarboximidamide (PubChem CID 135581665) has the molecular formula C23H27F3N4O4S and a molecular weight of 512.55 g/mol. Its IUPAC name is 4-hydroxy-3-[(E)-3-[4-(1-methylsulfonylpiperidin-4-yl)oxy-3-(trifluoromethyl)anilino]prop-1-enyl]benzenecarboximidamide.
| Compound Name | 4-hydroxy-3-[(E)-3-[4-(1-methylsulfonylpiperidin-4-yl)oxy-3-(trifluoromethyl)anilino]prop-1-enyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 135581665 |
| Molecular Formula | C23H27F3N4O4S |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 4-hydroxy-3-[(E)-3-[4-(1-methylsulfonylpiperidin-4-yl)oxy-3-(trifluoromethyl)anilino]prop-1-enyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(O)c(/C=C/CNc2ccc(OC3CCN(S(C)(=O)=O)CC3)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H27F3N4O4S/c1-35(32,33)30-11-8-18(9-12-30)34-21-7-5-17(14-19(21)23(24,25)26)29-10-2-3-15-13-16(22(27)28)4-6-20(15)31/h2-7,13-14,18,29,31H,8-12H2,1H3,(H3,27,28)/b3-2+ |
| InChIKey | CRUGEYOXRXIBLR-NSCUHMNNSA-N |
| XLogP | 3.62 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|