C8H7N3O2 — CID 135581712
4-amino-2-(furan-2-yl)-1H-pyrimidin-6-one (PubChem CID 135581712) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is 4-amino-2-(furan-2-yl)-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-(furan-2-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135581712 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 4-amino-2-(furan-2-yl)-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(-c2ccco2)n1 |
| InChI | InChI=1S/C8H7N3O2/c9-6-4-7(12)11-8(10-6)5-2-1-3-13-5/h1-4H,(H3,9,10,11,12) |
| InChIKey | HEHNLOYMBNTESC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |