About 3-amino-1H-indazol-4-ol
3-amino-1H-indazol-4-ol (PubChem CID 135583106) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 3-amino-1H-indazol-4-ol.
Molecular Properties
| Compound Name | 3-amino-1H-indazol-4-ol |
| PubChem CID | 135583106 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 3-amino-1H-indazol-4-ol |
| SMILES | Nc1n[nH]c2cccc(O)c12 |
| InChI | InChI=1S/C7H7N3O/c8-7-6-4(9-10-7)2-1-3-5(6)11/h1-3,11H,(H3,8,9,10) |
| InChIKey | PGBXYVFBYTUTLP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-1H-indazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1H-indazol-4-ol?
The IUPAC name of 3-amino-1H-indazol-4-ol (CID 135583106) is 3-amino-1H-indazol-4-ol.
What is the SMILES notation for 3-amino-1H-indazol-4-ol?
The canonical SMILES for 3-amino-1H-indazol-4-ol is Nc1n[nH]c2cccc(O)c12.
What is the InChIKey of 3-amino-1H-indazol-4-ol?
The InChIKey is PGBXYVFBYTUTLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c8-7-6-4(9-10-7)2-1-3-5(6)11/h1-3,11H,(H3,8,9,10).
What are the key properties of 3-amino-1H-indazol-4-ol?
3-amino-1H-indazol-4-ol has a molecular weight of 149.15 g/mol, XLogP of 0.85, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1H-indazol-4-ol is sourced from PubChem (CID 135583106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).