C17H18BrN3O2S — CID 135583138
N-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 135583138) has the molecular formula C17H18BrN3O2S and a molecular weight of 408.32 g/mol. Its IUPAC name is N-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 135583138 |
| Molecular Formula | C17H18BrN3O2S |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | N-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | Cc1cc(Br)cnc1CCCC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C17H18BrN3O2S/c1-12-10-13(18)11-20-15(12)7-4-5-9-19-17-14-6-2-3-8-16(14)24(22,23)21-17/h2-3,6,8,10-11H,4-5,7,9H2,1H3,(H,19,21) |
| InChIKey | FYQNWZKMYGERPZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|