C18H24N4O4S2 — CID 135583667
1-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanoyl]piperidine-3-carboxamide (PubChem CID 135583667) has the molecular formula C18H24N4O4S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 1-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanoyl]piperidine-3-carboxamide.
| Compound Name | 1-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 135583667 |
| Molecular Formula | C18H24N4O4S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 1-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanylbutanoyl]piperidine-3-carboxamide |
| SMILES | CSCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C18H24N4O4S2/c1-27-10-8-14(18(24)22-9-4-5-12(11-22)16(19)23)20-17-13-6-2-3-7-15(13)28(25,26)21-17/h2-3,6-7,12,14H,4-5,8-11H2,1H3,(H2,19,23)(H,20,21) |
| InChIKey | VBNIEWXSRIGWQC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|