C19H15ClN4O5S — CID 135583690
[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135583690) has the molecular formula C19H15ClN4O5S and a molecular weight of 446.87 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135583690 |
| Molecular Formula | C19H15ClN4O5S |
| Molecular Weight | 446.87 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)OCc1nnc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C19H15ClN4O5S/c1-11(21-17-14-4-2-3-5-15(14)30(26,27)24-17)19(25)28-10-16-22-23-18(29-16)12-6-8-13(20)9-7-12/h2-9,11H,10H2,1H3,(H,21,24) |
| InChIKey | CRQDCPAWQRHHGW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.87 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|