About 4,7-dihydro-1H-pyrazolo[5,4-b]pyridine
4,7-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 135583751) has the molecular formula C6H7N3
and a molecular weight of 121.14 g/mol. Its IUPAC name is 4,7-dihydro-1H-pyrazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
| PubChem CID | 135583751 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | 4,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | C1=CNc2[nH]ncc2C1 |
| InChI | InChI=1S/C6H7N3/c1-2-5-4-8-9-6(5)7-3-1/h1,3-4H,2H2,(H2,7,8,9) |
| InChIKey | CIYZIIKGSGGKHZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,7-dihydro-1H-pyrazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dihydro-1H-pyrazolo[5,4-b]pyridine?
The IUPAC name of 4,7-dihydro-1H-pyrazolo[5,4-b]pyridine (CID 135583751) is 4,7-dihydro-1H-pyrazolo[5,4-b]pyridine.
What is the SMILES notation for 4,7-dihydro-1H-pyrazolo[5,4-b]pyridine?
The canonical SMILES for 4,7-dihydro-1H-pyrazolo[5,4-b]pyridine is C1=CNc2[nH]ncc2C1.
What is the InChIKey of 4,7-dihydro-1H-pyrazolo[5,4-b]pyridine?
The InChIKey is CIYZIIKGSGGKHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3/c1-2-5-4-8-9-6(5)7-3-1/h1,3-4H,2H2,(H2,7,8,9).
What are the key properties of 4,7-dihydro-1H-pyrazolo[5,4-b]pyridine?
4,7-dihydro-1H-pyrazolo[5,4-b]pyridine has a molecular weight of 121.14 g/mol, XLogP of 0.89, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dihydro-1H-pyrazolo[5,4-b]pyridine is sourced from PubChem (CID 135583751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).