About propan-2-yl 4-(2-fluorophenyl)-6-methyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate
propan-2-yl 4-(2-fluorophenyl)-6-methyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate (PubChem CID 135583911) has the molecular formula C17H18FN3O2
and a molecular weight of 315.35 g/mol. Its IUPAC name is propan-2-yl 4-(2-fluorophenyl)-6-methyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 4-(2-fluorophenyl)-6-methyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate |
| PubChem CID | 135583911 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | propan-2-yl 4-(2-fluorophenyl)-6-methyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2ccccc2F)c2cn[nH]c2N1 |
| InChI | InChI=1S/C17H18FN3O2/c1-9(2)23-17(22)14-10(3)20-16-12(8-19-21-16)15(14)11-6-4-5-7-13(11)18/h4-9,15H,1-3H3,(H2,19,20,21) |
| InChIKey | FZBHKLJIFGHUDA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl 4-(2-fluorophenyl)-6-methyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-(2-fluorophenyl)-6-methyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate?
The IUPAC name of propan-2-yl 4-(2-fluorophenyl)-6-methyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate (CID 135583911) is propan-2-yl 4-(2-fluorophenyl)-6-methyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate.
What is the SMILES notation for propan-2-yl 4-(2-fluorophenyl)-6-methyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate?
The canonical SMILES for propan-2-yl 4-(2-fluorophenyl)-6-methyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate is CC1=C(C(=O)OC(C)C)C(c2ccccc2F)c2cn[nH]c2N1.
What is the InChIKey of propan-2-yl 4-(2-fluorophenyl)-6-methyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate?
The InChIKey is FZBHKLJIFGHUDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN3O2/c1-9(2)23-17(22)14-10(3)20-16-12(8-19-21-16)15(14)11-6-4-5-7-13(11)18/h4-9,15H,1-3H3,(H2,19,20,21).
What are the key properties of propan-2-yl 4-(2-fluorophenyl)-6-methyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate?
propan-2-yl 4-(2-fluorophenyl)-6-methyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate has a molecular weight of 315.35 g/mol, XLogP of 3.33, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-(2-fluorophenyl)-6-methyl-4,7-dihydro-1H-pyrazolo[5,4-b]pyridine-5-carboxylate is sourced from PubChem (CID 135583911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).