C12H18N2O2S — CID 135584595
8-hydroxy-7-pentyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one (PubChem CID 135584595) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 8-hydroxy-7-pentyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one.
| Compound Name | 8-hydroxy-7-pentyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one |
|---|---|
| PubChem CID | 135584595 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 8-hydroxy-7-pentyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazin-6-one |
| SMILES | CCCCCc1c(O)nc2n(c1=O)CCCS2 |
| InChI | InChI=1S/C12H18N2O2S/c1-2-3-4-6-9-10(15)13-12-14(11(9)16)7-5-8-17-12/h15H,2-8H2,1H3 |
| InChIKey | OBJSHVKGZHDIKO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|