About N-[(Z)-(2-oxo-1,3-thiazolidin-4-ylidene)amino]pyridine-4-carboxamide
N-[(Z)-(2-oxo-1,3-thiazolidin-4-ylidene)amino]pyridine-4-carboxamide (PubChem CID 135585311) has the molecular formula C9H8N4O2S
and a molecular weight of 236.26 g/mol. Its IUPAC name is N-[(Z)-(2-oxo-1,3-thiazolidin-4-ylidene)amino]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(Z)-(2-oxo-1,3-thiazolidin-4-ylidene)amino]pyridine-4-carboxamide |
| PubChem CID | 135585311 |
| Molecular Formula | C9H8N4O2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | N-[(Z)-(2-oxo-1,3-thiazolidin-4-ylidene)amino]pyridine-4-carboxamide |
| SMILES | O=C1N/C(=N\NC(=O)c2ccncc2)CS1 |
| InChI | InChI=1S/C9H8N4O2S/c14-8(6-1-3-10-4-2-6)13-12-7-5-16-9(15)11-7/h1-4H,5H2,(H,13,14)(H,11,12,15) |
| InChIKey | GSSZBJFIPRDSOF-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-(2-oxo-1,3-thiazolidin-4-ylidene)amino]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-(2-oxo-1,3-thiazolidin-4-ylidene)amino]pyridine-4-carboxamide?
The IUPAC name of N-[(Z)-(2-oxo-1,3-thiazolidin-4-ylidene)amino]pyridine-4-carboxamide (CID 135585311) is N-[(Z)-(2-oxo-1,3-thiazolidin-4-ylidene)amino]pyridine-4-carboxamide.
What is the SMILES notation for N-[(Z)-(2-oxo-1,3-thiazolidin-4-ylidene)amino]pyridine-4-carboxamide?
The canonical SMILES for N-[(Z)-(2-oxo-1,3-thiazolidin-4-ylidene)amino]pyridine-4-carboxamide is O=C1N/C(=N\NC(=O)c2ccncc2)CS1.
What is the InChIKey of N-[(Z)-(2-oxo-1,3-thiazolidin-4-ylidene)amino]pyridine-4-carboxamide?
The InChIKey is GSSZBJFIPRDSOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O2S/c14-8(6-1-3-10-4-2-6)13-12-7-5-16-9(15)11-7/h1-4H,5H2,(H,13,14)(H,11,12,15).
What are the key properties of N-[(Z)-(2-oxo-1,3-thiazolidin-4-ylidene)amino]pyridine-4-carboxamide?
N-[(Z)-(2-oxo-1,3-thiazolidin-4-ylidene)amino]pyridine-4-carboxamide has a molecular weight of 236.26 g/mol, XLogP of 0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-(2-oxo-1,3-thiazolidin-4-ylidene)amino]pyridine-4-carboxamide is sourced from PubChem (CID 135585311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).