About 6-(4-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinazolin-8-one
6-(4-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinazolin-8-one (PubChem CID 135585421) has the molecular formula C15H9FN2O3
and a molecular weight of 284.25 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinazolin-8-one.
Molecular Properties
| Compound Name | 6-(4-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinazolin-8-one |
| PubChem CID | 135585421 |
| Molecular Formula | C15H9FN2O3 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 6-(4-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinazolin-8-one |
| SMILES | O=c1[nH]c(-c2ccc(F)cc2)nc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C15H9FN2O3/c16-9-3-1-8(2-4-9)14-17-11-6-13-12(20-7-21-13)5-10(11)15(19)18-14/h1-6H,7H2,(H,17,18,19) |
| InChIKey | DHZJJCPICVTNAX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinazolin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinazolin-8-one?
The IUPAC name of 6-(4-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinazolin-8-one (CID 135585421) is 6-(4-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinazolin-8-one.
What is the SMILES notation for 6-(4-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinazolin-8-one?
The canonical SMILES for 6-(4-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinazolin-8-one is O=c1[nH]c(-c2ccc(F)cc2)nc2cc3c(cc12)OCO3.
What is the InChIKey of 6-(4-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinazolin-8-one?
The InChIKey is DHZJJCPICVTNAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9FN2O3/c16-9-3-1-8(2-4-9)14-17-11-6-13-12(20-7-21-13)5-10(11)15(19)18-14/h1-6H,7H2,(H,17,18,19).
What are the key properties of 6-(4-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinazolin-8-one?
6-(4-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinazolin-8-one has a molecular weight of 284.25 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluorophenyl)-7H-[1,3]dioxolo[4,5-g]quinazolin-8-one is sourced from PubChem (CID 135585421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).