About ethyl 4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]benzoate
ethyl 4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]benzoate (PubChem CID 135585807) has the molecular formula C26H24N2O5
and a molecular weight of 444.49 g/mol. Its IUPAC name is ethyl 4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]benzoate |
| PubChem CID | 135585807 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | ethyl 4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C(\c2ccccc2)c2c(O)[nH]c3cc(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C26H24N2O5/c1-4-33-26(30)17-10-12-18(13-11-17)27-24(16-8-6-5-7-9-16)23-19-14-21(31-2)22(32-3)15-20(19)28-25(23)29/h5-15,28-29H,4H2,1-3H3/b27-24+ |
| InChIKey | NAYPUNGPDKEMLN-SOYKGTTHSA-N |
| XLogP | 5.24 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]benzoate?
The IUPAC name of ethyl 4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]benzoate (CID 135585807) is ethyl 4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]benzoate.
What is the SMILES notation for ethyl 4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]benzoate?
The canonical SMILES for ethyl 4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]benzoate is CCOC(=O)c1ccc(/N=C(\c2ccccc2)c2c(O)[nH]c3cc(OC)c(OC)cc23)cc1.
What is the InChIKey of ethyl 4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]benzoate?
The InChIKey is NAYPUNGPDKEMLN-SOYKGTTHSA-N. The full InChI is InChI=1S/C26H24N2O5/c1-4-33-26(30)17-10-12-18(13-11-17)27-24(16-8-6-5-7-9-16)23-19-14-21(31-2)22(32-3)15-20(19)28-25(23)29/h5-15,28-29H,4H2,1-3H3/b27-24+.
What are the key properties of ethyl 4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]benzoate?
ethyl 4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]benzoate has a molecular weight of 444.49 g/mol, XLogP of 5.24, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]benzoate is sourced from PubChem (CID 135585807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).