About N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide
N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide (PubChem CID 135587751) has the molecular formula C11H13N5O3S
and a molecular weight of 295.32 g/mol. Its IUPAC name is N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide.
Molecular Properties
| Compound Name | N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide |
| PubChem CID | 135587751 |
| Molecular Formula | C11H13N5O3S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cc(O)c(-n2[nH]nnc2=S)cc1O |
| InChI | InChI=1S/C11H13N5O3S/c1-2-3-10(19)12-6-4-9(18)7(5-8(6)17)16-11(20)13-14-15-16/h4-5,17-18H,2-3H2,1H3,(H,12,19)(H,13,15,20) |
| InChIKey | NULVDKCTIKRUAH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide?
The IUPAC name of N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide (CID 135587751) is N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide.
What is the SMILES notation for N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide?
The canonical SMILES for N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide is CCCC(=O)Nc1cc(O)c(-n2[nH]nnc2=S)cc1O.
What is the InChIKey of N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide?
The InChIKey is NULVDKCTIKRUAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5O3S/c1-2-3-10(19)12-6-4-9(18)7(5-8(6)17)16-11(20)13-14-15-16/h4-5,17-18H,2-3H2,1H3,(H,12,19)(H,13,15,20).
What are the key properties of N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide?
N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide has a molecular weight of 295.32 g/mol, XLogP of 1.47, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide is sourced from PubChem (CID 135587751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).