C11H13N5O3S — CID 135587751
N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide (PubChem CID 135587751) has the molecular formula C11H13N5O3S and a molecular weight of 295.32 g/mol. Its IUPAC name is N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide.
| Compound Name | N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 135587751 |
| Molecular Formula | C11H13N5O3S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | N-[2,5-dihydroxy-4-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cc(O)c(-n2[nH]nnc2=S)cc1O |
| InChI | InChI=1S/C11H13N5O3S/c1-2-3-10(19)12-6-4-9(18)7(5-8(6)17)16-11(20)13-14-15-16/h4-5,17-18H,2-3H2,1H3,(H,12,19)(H,13,15,20) |
| InChIKey | NULVDKCTIKRUAH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|