About 5,8-dimethylquinolino[3,2-c]acridine-6,7-diol
5,8-dimethylquinolino[3,2-c]acridine-6,7-diol (PubChem CID 135588744) has the molecular formula C22H16N2O2
and a molecular weight of 340.38 g/mol. Its IUPAC name is 5,8-dimethylquinolino[3,2-c]acridine-6,7-diol.
Molecular Properties
| Compound Name | 5,8-dimethylquinolino[3,2-c]acridine-6,7-diol |
| PubChem CID | 135588744 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 5,8-dimethylquinolino[3,2-c]acridine-6,7-diol |
| SMILES | Cc1c2ccccc2nc2c1c(O)c(O)c1c(C)c3ccccc3nc12 |
| InChI | InChI=1S/C22H16N2O2/c1-11-13-7-3-5-9-15(13)23-19-17(11)21(25)22(26)18-12(2)14-8-4-6-10-16(14)24-20(18)19/h3-10,25-26H,1-2H3 |
| InChIKey | PNWFWWBEUJRIDK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5,8-dimethylquinolino[3,2-c]acridine-6,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dimethylquinolino[3,2-c]acridine-6,7-diol?
The IUPAC name of 5,8-dimethylquinolino[3,2-c]acridine-6,7-diol (CID 135588744) is 5,8-dimethylquinolino[3,2-c]acridine-6,7-diol.
What is the SMILES notation for 5,8-dimethylquinolino[3,2-c]acridine-6,7-diol?
The canonical SMILES for 5,8-dimethylquinolino[3,2-c]acridine-6,7-diol is Cc1c2ccccc2nc2c1c(O)c(O)c1c(C)c3ccccc3nc12.
What is the InChIKey of 5,8-dimethylquinolino[3,2-c]acridine-6,7-diol?
The InChIKey is PNWFWWBEUJRIDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O2/c1-11-13-7-3-5-9-15(13)23-19-17(11)21(25)22(26)18-12(2)14-8-4-6-10-16(14)24-20(18)19/h3-10,25-26H,1-2H3.
What are the key properties of 5,8-dimethylquinolino[3,2-c]acridine-6,7-diol?
5,8-dimethylquinolino[3,2-c]acridine-6,7-diol has a molecular weight of 340.38 g/mol, XLogP of 5.12, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dimethylquinolino[3,2-c]acridine-6,7-diol is sourced from PubChem (CID 135588744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).